| Name |
3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-{hexahydro-1H-furo[3,4-c]pyrrol-5-yl}-4-oxobutanoic acid
|
| Molecular Formula |
C25H26N2O6
|
| Molecular Weight |
450.5
|
| Smiles |
O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1CC2COCC2C1
|
O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1CC2COCC2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.