| Name |
5-Methyl-2-(3-{octahydrocyclopenta[c]pyrrol-2-yl}azetidin-1-yl)-1,3-thiazole
|
| Molecular Formula |
C14H21N3S
|
| Molecular Weight |
263.40
|
| Smiles |
Cc1cnc(N2CC(N3CC4CCCC4C3)C2)s1
|
Cc1cnc(N2CC(N3CC4CCCC4C3)C2)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.