| Name |
dibutyl hydrogen phosphate;(Z)-octadec-9-en-1-amine
|
| Molecular Formula |
C26H56NO4P
|
| Molecular Weight |
477.7
|
| Smiles |
CCCCCCCCC=CCCCCCCCCN.CCCCOP(=O)(O)OCCCC
|
CCCCCCCCC=CCCCCCCCCN.CCCCOP(=O)(O)OCCCC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.