| Name |
5-Amino-1-({bicyclo[3.1.0]hexan-3-yl}methyl)-1,2-dihydropyridin-2-one
|
| Molecular Formula |
C12H16N2O
|
| Molecular Weight |
204.27
|
| Smiles |
Nc1ccc(=O)n(CC2CC3CC3C2)c1
|
Nc1ccc(=O)n(CC2CC3CC3C2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.