| Name |
rac-methyl 5-amino-2-bromo-1-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]-1H-imidazole-4-carboxylate
|
| Molecular Formula |
C9H9BrF3N3O2
|
| Molecular Weight |
328.09
|
| Smiles |
COC(=O)c1nc(Br)n(C2CC2C(F)(F)F)c1N
|
COC(=O)c1nc(Br)n(C2CC2C(F)(F)F)c1N
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.