| Name |
5-Phenyl-1,2,3-thiadiazole-4-sulfonyl fluoride
|
| Molecular Formula |
C8H5FN2O2S2
|
| Molecular Weight |
244.3
|
| Smiles |
O=S(=O)(F)c1nnsc1-c1ccccc1
|
O=S(=O)(F)c1nnsc1-c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.