| Name |
1',7-Di-tert-butyl 4-amino-3,4-dihydrospiro[1-benzopyran-2,3'-pyrrolidine]-1',7-dicarboxylate
|
| Molecular Formula |
C22H32N2O5
|
| Molecular Weight |
404.5
|
| Smiles |
CC(C)(C)OC(=O)c1ccc2c(c1)OC1(CCN(C(=O)OC(C)(C)C)C1)CC2N
|
CC(C)(C)OC(=O)c1ccc2c(c1)OC1(CCN(C(=O)OC(C)(C)C)C1)CC2N
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.