| Name |
5-{7-chloro-2-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl}-1-methyl-1H-pyrazole
|
| Molecular Formula |
C11H11ClN6
|
| Molecular Weight |
262.70
|
| Smiles |
CCc1nc2nc(-c3ccnn3C)cc(Cl)n2n1
|
CCc1nc2nc(-c3ccnn3C)cc(Cl)n2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.