| Name |
tert-butyl 3-ethyl-2H,4H,5H,6H,7H-pyrazolo[4,3-c]pyridine-5-carboxylate
|
| Molecular Formula |
C13H21N3O2
|
| Molecular Weight |
251.32
|
| Smiles |
CCc1n[nH]c2c1CN(C(=O)OC(C)(C)C)CC2
|
CCc1n[nH]c2c1CN(C(=O)OC(C)(C)C)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.