| Name |
Pyrido[1,2-b][1,2]benzothiazine-10,11(7H,10aH)-dione, 8,9-dihydro-, 5,5-dioxide
|
| Molecular Formula |
C12H11NO4S
|
| Molecular Weight |
265.29
|
| Smiles |
O=C1CCCN2C1C(=O)c1ccccc1S2(=O)=O
|
O=C1CCCN2C1C(=O)c1ccccc1S2(=O)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.