| Name |
2-{4-[(benzyloxy)carbonyl]-5,7-dimethyl-2-oxo-1H,2H,4H,5H,6H,7H-pyrazolo[1,5-a]pyrimidin-6-yl}acetic acid
|
| Molecular Formula |
C18H21N3O5
|
| Molecular Weight |
359.4
|
| Smiles |
CC1C(CC(=O)O)C(C)n2[nH]c(=O)cc2N1C(=O)OCc1ccccc1
|
CC1C(CC(=O)O)C(C)n2[nH]c(=O)cc2N1C(=O)OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.