| Name |
(2S,3R)-3-(benzyloxy)-2-{3-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethoxy]propanamido}butanoic acid
|
| Molecular Formula |
C31H34N2O7
|
| Molecular Weight |
546.6
|
| Smiles |
CC(OCc1ccccc1)C(NC(=O)CCOCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O
|
CC(OCc1ccccc1)C(NC(=O)CCOCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.