| Name |
tert-butyl 4-(4-fluorophenyl)-3H,4H,5H,6H,7H-imidazo[4,5-c]pyridine-6-carboxylate
|
| Molecular Formula |
C17H20FN3O2
|
| Molecular Weight |
317.36
|
| Smiles |
CC(C)(C)OC(=O)C1Cc2[nH]cnc2C(c2ccc(F)cc2)N1
|
CC(C)(C)OC(=O)C1Cc2[nH]cnc2C(c2ccc(F)cc2)N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.