| Name |
rac-(3'aR,6'aR)-1,5'-bis[(tert-butoxy)carbonyl]-hexahydrospiro[azetidine-3,1'-furo[3,4-c]pyrrole]-3'a-carboxylic acid
|
| Molecular Formula |
C19H30N2O7
|
| Molecular Weight |
398.5
|
| Smiles |
CC(C)(C)OC(=O)N1CC2(C1)OCC1(C(=O)O)CN(C(=O)OC(C)(C)C)CC21
|
CC(C)(C)OC(=O)N1CC2(C1)OCC1(C(=O)O)CN(C(=O)OC(C)(C)C)CC21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.