| Name |
4-Amino-3-[2-[4-[2-(2,4-diamino-5-sulfophenyl)diazenyl]phenyl]diazenyl]-5-hydroxy-6-[2-(4-octylphenyl)diazenyl]-2,7-naphthalenedisulfonic acid
|
| Molecular Formula |
C36H39N9O10S3
|
| Molecular Weight |
854.0
|
| Smiles |
CCCCCCCCc1ccc(N=Nc2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(N=Nc4ccc(N=Nc5cc(S(=O)(=O)O)c(N)cc5N)cc4)c(N)c3c2O)cc1
|
CCCCCCCCc1ccc(N=Nc2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(N=Nc4ccc(N=Nc5cc(S(=O)(=O)O)c(N)cc5N)cc4)c(N)c3c2O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.