| Name |
1,1-difluoro-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propan-2-amine
|
| Molecular Formula |
C9H11F2N5
|
| Molecular Weight |
227.21
|
| Smiles |
CC(N)(Cc1cnc2n[nH]nc2c1)C(F)F
|
CC(N)(Cc1cnc2n[nH]nc2c1)C(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.