| Name |
[2,2'-Bipyridin]-6(1H)-one, 5'-fluoro-
|
| Molecular Formula |
C10H7FN2O
|
| Molecular Weight |
190.17
|
| Smiles |
O=c1cccc(-c2ccc(F)cn2)[nH]1
|
O=c1cccc(-c2ccc(F)cn2)[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.