| Name |
4-{3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]propanamido}but-2-enoic acid
|
| Molecular Formula |
C28H26N2O5
|
| Molecular Weight |
470.5
|
| Smiles |
O=C(O)C=CCNC(=O)CCc1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1
|
O=C(O)C=CCNC(=O)CCc1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.