| Name |
(1H-indol-4-yl)methyl sulfamate
|
| Molecular Formula |
C9H10N2O3S
|
| Molecular Weight |
226.25
|
| Smiles |
NS(=O)(=O)OCc1cccc2[nH]ccc12
|
NS(=O)(=O)OCc1cccc2[nH]ccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.