| Name |
{1,4,9-Trioxadispiro[4.1.4^{7}.1^{5}]dodecan-10-yl}methanesulfonyl chloride
|
| Molecular Formula |
C10H15ClO5S
|
| Molecular Weight |
282.74
|
| Smiles |
O=S(=O)(Cl)CC1CC2(CO1)CC1(C2)OCCO1
|
O=S(=O)(Cl)CC1CC2(CO1)CC1(C2)OCCO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.