| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propanoate
|
| Molecular Formula |
C20H13FN2O5
|
| Molecular Weight |
380.3
|
| Smiles |
O=C(CCc1ncc(-c2ccccc2F)o1)ON1C(=O)c2ccccc2C1=O
|
O=C(CCc1ncc(-c2ccccc2F)o1)ON1C(=O)c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.