| Name |
3-[2-[3-[[(1R)-1-[(2R,4S)-4-hydroxy-2-[[4-(4-methylthiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidine-1-carbonyl]-2,2-dimethyl-propyl]amino]-3-oxo-propoxy]ethoxy]propanoic acid
|
| Molecular Formula |
C30H42N4O8S
|
| Molecular Weight |
618.7
|
| Smiles |
Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)CCOCCOCCC(=O)O)C(C)(C)C)cc1
|
Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)CCOCCOCCC(=O)O)C(C)(C)C)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.