| Name |
Anthra[1,9-cd]pyrazol-6(2H)-one, hydrazone
|
| Molecular Formula |
C14H10N4
|
| Molecular Weight |
234.26
|
| Smiles |
NN=C1c2ccccc2-c2n[nH]c3cccc1c23
|
NN=C1c2ccccc2-c2n[nH]c3cccc1c23
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.