| Name |
rel-(+)-Methyl (1R,2S,3S)-3-(3,4-dihydroxyphenyl)-2,3-dihydro-5,6-dihydroxy-2-(methoxycarbonyl)-1H-indene-1-acetate
|
| Molecular Formula |
C20H20O8
|
| Molecular Weight |
388.4
|
| Smiles |
COC(=O)CC1c2cc(O)c(O)cc2C(c2ccc(O)c(O)c2)C1C(=O)OC
|
COC(=O)CC1c2cc(O)c(O)cc2C(c2ccc(O)c(O)c2)C1C(=O)OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.