| Name |
3-{2-ethyl-2-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]butanoyl}-2-methyl-1,3-thiazolidine-4-carboxylic acid
|
| Molecular Formula |
C27H32N2O5S
|
| Molecular Weight |
496.6
|
| Smiles |
CCC(CC)(CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1C(C)SCC1C(=O)O
|
CCC(CC)(CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1C(C)SCC1C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.