| Name |
6-(Acetyloxy)-5,7-dinitro-1,3-benzoxathiol-2-one
|
| Molecular Formula |
C9H4N2O8S
|
| Molecular Weight |
300.20
|
| Smiles |
CC(=O)Oc1c([N+](=O)[O-])cc2sc(=O)oc2c1[N+](=O)[O-]
|
CC(=O)Oc1c([N+](=O)[O-])cc2sc(=O)oc2c1[N+](=O)[O-]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.