| Name |
2,3,4-Triacetate 3,7-Dihydroxy-15-yl Methyl Ester beta-D-Glucopyranosiduronic Acid
|
| Molecular Formula |
C28H36O15
|
| Molecular Weight |
612.6
|
| Smiles |
COC(=O)C1OC(OCC23C(C=C(C)C(=O)C2O)OC2C(O)CC3(C)C23CO3)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O
|
COC(=O)C1OC(OCC23C(C=C(C)C(=O)C2O)OC2C(O)CC3(C)C23CO3)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.