| Name |
4lambda6,12lambda6,16lambda6,24lambda6-Tetrathia-1,3,7,9,13,15,19,21-octazapentacyclo[19.3.1.13,7.19,13.115,19]octacosane 4,4,12,12,16,16,24,24-octaoxide
|
| Molecular Formula |
C16H32N8O8S4
|
| Molecular Weight |
592.7
|
| Smiles |
O=S1(=O)CCN2CN3CCS(=O)(=O)N(C3)CN3CN(CCS3(=O)=O)CN3CCS(=O)(=O)N(C3)CN1C2
|
O=S1(=O)CCN2CN3CCS(=O)(=O)N(C3)CN3CN(CCS3(=O)=O)CN3CCS(=O)(=O)N(C3)CN1C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.