| Name |
2-Chloro-5-{pyrazolo[1,5-a]pyrimidin-3-yl}-1,3-thiazole
|
| Molecular Formula |
C9H5ClN4S
|
| Molecular Weight |
236.68
|
| Smiles |
Clc1ncc(-c2cnn3cccnc23)s1
|
Clc1ncc(-c2cnn3cccnc23)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.