| Name |
Phosphine, butylbis(tricyclo[3.3.1.13,7]dec-1-yl)-, tetrafluoroborate(1-) (1:1)
|
| Molecular Formula |
C24H39BF4P-
|
| Molecular Weight |
445.3
|
| Smiles |
CCCCP(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.F[B-](F)(F)F
|
CCCCP(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.F[B-](F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.