| Name |
2-(4-fluorophenyl)-5-{[3-(trifluoromethyl)phenyl]methyl}-4H,5H-pyrazolo[1,5-a]pyrazin-4-one
|
| Molecular Formula |
C20H13F4N3O
|
| Molecular Weight |
387.3
|
| Smiles |
O=c1c2cc(-c3ccc(F)cc3)nn2ccn1Cc1cccc(C(F)(F)F)c1
|
O=c1c2cc(-c3ccc(F)cc3)nn2ccn1Cc1cccc(C(F)(F)F)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.