| Name |
1-{2,5-Dimethylpyrazolo[1,5-a]pyrimidin-7-yl}-4-(propane-2-sulfonyl)piperazine
|
| Molecular Formula |
C15H23N5O2S
|
| Molecular Weight |
337.4
|
| Smiles |
Cc1cc(N2CCN(S(=O)(=O)C(C)C)CC2)n2nc(C)cc2n1
|
Cc1cc(N2CCN(S(=O)(=O)C(C)C)CC2)n2nc(C)cc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.