| Name |
2-{5-[(2,4-Dimethyl-1,3-thiazol-5-yl)methyl]-octahydropyrrolo[3,4-c]pyrrol-2-yl}pyridine-3-carbonitrile
|
| Molecular Formula |
C18H21N5S
|
| Molecular Weight |
339.5
|
| Smiles |
Cc1nc(C)c(CN2CC3CN(c4ncccc4C#N)CC3C2)s1
|
Cc1nc(C)c(CN2CC3CN(c4ncccc4C#N)CC3C2)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.