| Name |
N-methyl-N-(1-{3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl}piperidin-4-yl)cyclopropanesulfonamide
|
| Molecular Formula |
C15H22N6O2S
|
| Molecular Weight |
350.4
|
| Smiles |
Cc1nnc2c(N3CCC(N(C)S(=O)(=O)C4CC4)CC3)nccn12
|
Cc1nnc2c(N3CCC(N(C)S(=O)(=O)C4CC4)CC3)nccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.