| Name |
2-(3-fluorophenyl)-4,5-dimethyl-1H-imidazole
|
| Molecular Formula |
C11H11FN2
|
| Molecular Weight |
190.22
|
| Smiles |
Cc1nc(-c2cccc(F)c2)[nH]c1C
|
Cc1nc(-c2cccc(F)c2)[nH]c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.