| Name |
N-methyl-1,1-dioxo-N-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-1,2-benzothiazol-3-amine
|
| Molecular Formula |
C21H22F3N3O2S
|
| Molecular Weight |
437.5
|
| Smiles |
CN(C1=NS(=O)(=O)c2ccccc21)C1CCN(Cc2ccc(C(F)(F)F)cc2)CC1
|
CN(C1=NS(=O)(=O)c2ccccc21)C1CCN(Cc2ccc(C(F)(F)F)cc2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.