| Name |
N-(3-Nitrophenyl-1,2,3,4,5,6-13C6)acetamide
|
| Molecular Formula |
C8H8N2O3
|
| Molecular Weight |
186.12
|
| Smiles |
CC(=O)Nc1cccc([N+](=O)[O-])c1
|
CC(=O)Nc1cccc([N+](=O)[O-])c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.