| Name |
3-[2-[(3,5-Dimethyl-1,2-oxazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,2-benzothiazole 1,1-dioxide
|
| Molecular Formula |
C19H22N4O3S
|
| Molecular Weight |
386.5
|
| Smiles |
Cc1noc(C)c1CN1CC2CN(C3=NS(=O)(=O)c4ccccc43)CC2C1
|
Cc1noc(C)c1CN1CC2CN(C3=NS(=O)(=O)c4ccccc43)CC2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.