| Name |
8-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazin-1-yl]-7-[(2E)-3-chlorobut-2-en-1-yl]-1,3-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione
|
| Molecular Formula |
C18H18BrClN6O3
|
| Molecular Weight |
481.7
|
| Smiles |
CC(Cl)=CCn1c(NN=Cc2cc(Br)ccc2O)nc2c1c(=O)n(C)c(=O)n2C
|
CC(Cl)=CCn1c(NN=Cc2cc(Br)ccc2O)nc2c1c(=O)n(C)c(=O)n2C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.