| Name |
6-Fluoro-3-(1-{2-methylpyrido[3,4-d]pyrimidin-4-yl}piperidin-4-yl)-1,2-benzoxazole
|
| Molecular Formula |
C20H18FN5O
|
| Molecular Weight |
363.4
|
| Smiles |
Cc1nc(N2CCC(c3noc4cc(F)ccc34)CC2)c2ccncc2n1
|
Cc1nc(N2CCC(c3noc4cc(F)ccc34)CC2)c2ccncc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.