| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (2R)-2-[2-(1H-1,2,3,4-tetrazol-1-yl)acetamido]propanoate
|
| Molecular Formula |
C14H12N6O5
|
| Molecular Weight |
344.28
|
| Smiles |
CC(NC(=O)Cn1cnnn1)C(=O)ON1C(=O)c2ccccc2C1=O
|
CC(NC(=O)Cn1cnnn1)C(=O)ON1C(=O)c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.