| Name |
4-(2-{4-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]-1H-1,2,3-triazol-1-yl}acetamido)-2-methylbut-2-enoic acid
|
| Molecular Formula |
C25H25N5O5
|
| Molecular Weight |
475.5
|
| Smiles |
CC(=CCNC(=O)Cn1cc(CNC(=O)OCC2c3ccccc3-c3ccccc32)nn1)C(=O)O
|
CC(=CCNC(=O)Cn1cc(CNC(=O)OCC2c3ccccc3-c3ccccc32)nn1)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.