| Name |
(4R)-3-{5-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]-1,2-oxazole-3-carbonyl}-1,3-thiazolidine-4-carboxylic acid
|
| Molecular Formula |
C24H21N3O6S
|
| Molecular Weight |
479.5
|
| Smiles |
O=C(NCc1cc(C(=O)N2CSCC2C(=O)O)no1)OCC1c2ccccc2-c2ccccc21
|
O=C(NCc1cc(C(=O)N2CSCC2C(=O)O)no1)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.