| Name |
tert-butyl N-(1-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}-2-oxoethyl)carbamate
|
| Molecular Formula |
C16H25NO3
|
| Molecular Weight |
279.37
|
| Smiles |
CC(C)(C)OC(=O)NC(C=O)C1=CCC2CC1C2(C)C
|
CC(C)(C)OC(=O)NC(C=O)C1=CCC2CC1C2(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.