| Name |
Phenol, 2-methoxy-5-methyl-, carbonate (2:1)
|
| Molecular Formula |
C17H18O5
|
| Molecular Weight |
302.32
|
| Smiles |
COc1ccc(C)cc1OC(=O)Oc1cc(C)ccc1OC
|
COc1ccc(C)cc1OC(=O)Oc1cc(C)ccc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.