| Name |
5-formamido-1H-1,2,4-triazole-3-sulfonyl fluoride
|
| Molecular Formula |
C3H3FN4O3S
|
| Molecular Weight |
194.15
|
| Smiles |
O=CNc1n[nH]c(S(=O)(=O)F)n1
|
O=CNc1n[nH]c(S(=O)(=O)F)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.