| Name |
tert-Butyl ((2R,4R)-4-aminopentan-2-yl)carbamate hydrochloride
|
| Molecular Formula |
C10H23ClN2O2
|
| Molecular Weight |
238.75
|
| Smiles |
CC(N)CC(C)NC(=O)OC(C)(C)C.Cl
|
CC(N)CC(C)NC(=O)OC(C)(C)C.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.