| Name |
N-[(4-fluoro-1-{7-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl}piperidin-4-yl)methyl]oxolane-3-carboxamide
|
| Molecular Formula |
C18H24FN5O2
|
| Molecular Weight |
361.4
|
| Smiles |
Cn1ccc2c(N3CCC(F)(CNC(=O)C4CCOC4)CC3)ncnc21
|
Cn1ccc2c(N3CCC(F)(CNC(=O)C4CCOC4)CC3)ncnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.