| Name |
tert-butyl N-{[5-(hydroxymethyl)-4H-1,2,4-triazol-3-yl]methyl}carbamate
|
| Molecular Formula |
C9H16N4O3
|
| Molecular Weight |
228.25
|
| Smiles |
CC(C)(C)OC(=O)NCc1nc(CO)n[nH]1
|
CC(C)(C)OC(=O)NCc1nc(CO)n[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.