| Name |
3,4,9-Trimethyl-1-propan-2-yl-7-propyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione
|
| Molecular Formula |
C16H25N6O2+
|
| Molecular Weight |
333.41
|
| Smiles |
CCCN1C(=O)C2C(=NC3=[N+]2C(C)C(C)=NN3C(C)C)N(C)C1=O
|
CCCN1C(=O)C2C(=NC3=[N+]2C(C)C(C)=NN3C(C)C)N(C)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.